C13H11NOS — CID 114389678
N-but-3-yn-2-yl-1-benzothiophene-2-carboxamide (PubChem CID 114389678) has the molecular formula C13H11NOS and a molecular weight of 229.30 g/mol. Its IUPAC name is N-but-3-yn-2-yl-1-benzothiophene-2-carboxamide.
| Compound Name | N-but-3-yn-2-yl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 114389678 |
| Molecular Formula | C13H11NOS |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | N-but-3-yn-2-yl-1-benzothiophene-2-carboxamide |
| SMILES | C#CC(C)NC(=O)c1cc2ccccc2s1 |
| InChI | InChI=1S/C13H11NOS/c1-3-9(2)14-13(15)12-8-10-6-4-5-7-11(10)16-12/h1,4-9H,2H3,(H,14,15) |
| InChIKey | QYPZHPUWOCYQKE-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|