C15H13N3O3S2 — CID 58418239
2-[(1R)-1-(1-benzothiophene-2-carbonylamino)ethyl]-N-hydroxy-1,3-thiazole-5-carboxamide (PubChem CID 58418239) has the molecular formula C15H13N3O3S2 and a molecular weight of 347.42 g/mol. Its IUPAC name is 2-[(1R)-1-(1-benzothiophene-2-carbonylamino)ethyl]-N-hydroxy-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[(1R)-1-(1-benzothiophene-2-carbonylamino)ethyl]-N-hydroxy-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 58418239 |
| Molecular Formula | C15H13N3O3S2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | 2-[(1R)-1-(1-benzothiophene-2-carbonylamino)ethyl]-N-hydroxy-1,3-thiazole-5-carboxamide |
| SMILES | C[C@@H](NC(=O)c1cc2ccccc2s1)c1ncc(C(=O)NO)s1 |
| InChI | InChI=1S/C15H13N3O3S2/c1-8(15-16-7-12(23-15)14(20)18-21)17-13(19)11-6-9-4-2-3-5-10(9)22-11/h2-8,21H,1H3,(H,17,19)(H,18,20)/t8-/m1/s1 |
| InChIKey | PZXXAXBJSARIMY-MRVPVSSYSA-N |
| XLogP | 2.97 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|