C17H13F2NOS — CID 134049414
N-[1-(3,4-difluorophenyl)ethyl]-1-benzothiophene-2-carboxamide (PubChem CID 134049414) has the molecular formula C17H13F2NOS and a molecular weight of 317.36 g/mol. Its IUPAC name is N-[1-(3,4-difluorophenyl)ethyl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-[1-(3,4-difluorophenyl)ethyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 134049414 |
| Molecular Formula | C17H13F2NOS |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | N-[1-(3,4-difluorophenyl)ethyl]-1-benzothiophene-2-carboxamide |
| SMILES | CC(NC(=O)c1cc2ccccc2s1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H13F2NOS/c1-10(11-6-7-13(18)14(19)8-11)20-17(21)16-9-12-4-2-3-5-15(12)22-16/h2-10H,1H3,(H,20,21) |
| InChIKey | CGRGIRGADQUJDG-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |