C15H12FNOS2 — CID 46636468
5-fluoro-N-(1-thiophen-2-ylethyl)-1-benzothiophene-2-carboxamide (PubChem CID 46636468) has the molecular formula C15H12FNOS2 and a molecular weight of 305.40 g/mol. Its IUPAC name is 5-fluoro-N-(1-thiophen-2-ylethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 5-fluoro-N-(1-thiophen-2-ylethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 46636468 |
| Molecular Formula | C15H12FNOS2 |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 5-fluoro-N-(1-thiophen-2-ylethyl)-1-benzothiophene-2-carboxamide |
| SMILES | CC(NC(=O)c1cc2cc(F)ccc2s1)c1cccs1 |
| InChI | InChI=1S/C15H12FNOS2/c1-9(12-3-2-6-19-12)17-15(18)14-8-10-7-11(16)4-5-13(10)20-14/h2-9H,1H3,(H,17,18) |
| InChIKey | SQESVAZCYRXNCC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |