C19H18FNO2S2 — CID 126853656
5-fluoro-N-[oxan-4-yl(thiophen-2-yl)methyl]-1-benzothiophene-2-carboxamide (PubChem CID 126853656) has the molecular formula C19H18FNO2S2 and a molecular weight of 375.49 g/mol. Its IUPAC name is 5-fluoro-N-[oxan-4-yl(thiophen-2-yl)methyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 5-fluoro-N-[oxan-4-yl(thiophen-2-yl)methyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 126853656 |
| Molecular Formula | C19H18FNO2S2 |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 5-fluoro-N-[oxan-4-yl(thiophen-2-yl)methyl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NC(c1cccs1)C1CCOCC1)c1cc2cc(F)ccc2s1 |
| InChI | InChI=1S/C19H18FNO2S2/c20-14-3-4-15-13(10-14)11-17(25-15)19(22)21-18(16-2-1-9-24-16)12-5-7-23-8-6-12/h1-4,9-12,18H,5-8H2,(H,21,22) |
| InChIKey | NAJOACDTTNLMHQ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |