C15H17NOS2 — CID 39032304
N-[(R)-cyclopentyl(thiophen-2-yl)methyl]thiophene-2-carboxamide (PubChem CID 39032304) has the molecular formula C15H17NOS2 and a molecular weight of 291.44 g/mol. Its IUPAC name is N-[(R)-cyclopentyl(thiophen-2-yl)methyl]thiophene-2-carboxamide.
| Compound Name | N-[(R)-cyclopentyl(thiophen-2-yl)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 39032304 |
| Molecular Formula | C15H17NOS2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | N-[(R)-cyclopentyl(thiophen-2-yl)methyl]thiophene-2-carboxamide |
| SMILES | O=C(N[C@@H](c1cccs1)C1CCCC1)c1cccs1 |
| InChI | InChI=1S/C15H17NOS2/c17-15(13-8-4-10-19-13)16-14(11-5-1-2-6-11)12-7-3-9-18-12/h3-4,7-11,14H,1-2,5-6H2,(H,16,17)/t14-/m1/s1 |
| InChIKey | AIFKIPJJOBMTKK-CQSZACIVSA-N |
| XLogP | 4.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |