C12H18N2OS — CID 94152755
1-[(R)-cyclopentyl(thiophen-2-yl)methyl]-3-methylurea (PubChem CID 94152755) has the molecular formula C12H18N2OS and a molecular weight of 238.36 g/mol. Its IUPAC name is 1-[(R)-cyclopentyl(thiophen-2-yl)methyl]-3-methylurea.
| Compound Name | 1-[(R)-cyclopentyl(thiophen-2-yl)methyl]-3-methylurea |
|---|---|
| PubChem CID | 94152755 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 1-[(R)-cyclopentyl(thiophen-2-yl)methyl]-3-methylurea |
| SMILES | CNC(=O)N[C@@H](c1cccs1)C1CCCC1 |
| InChI | InChI=1S/C12H18N2OS/c1-13-12(15)14-11(9-5-2-3-6-9)10-7-4-8-16-10/h4,7-9,11H,2-3,5-6H2,1H3,(H2,13,14,15)/t11-/m1/s1 |
| InChIKey | VTHUDOSTVQTQSF-LLVKDONJSA-N |
| XLogP | 2.91 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |