C17H20N2O2S2 — CID 42960858
N-[2-[[cyclopentyl(thiophen-2-yl)methyl]amino]-2-oxoethyl]thiophene-2-carboxamide (PubChem CID 42960858) has the molecular formula C17H20N2O2S2 and a molecular weight of 348.49 g/mol. Its IUPAC name is N-[2-[[cyclopentyl(thiophen-2-yl)methyl]amino]-2-oxoethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[[cyclopentyl(thiophen-2-yl)methyl]amino]-2-oxoethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 42960858 |
| Molecular Formula | C17H20N2O2S2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | N-[2-[[cyclopentyl(thiophen-2-yl)methyl]amino]-2-oxoethyl]thiophene-2-carboxamide |
| SMILES | O=C(CNC(=O)c1cccs1)NC(c1cccs1)C1CCCC1 |
| InChI | InChI=1S/C17H20N2O2S2/c20-15(11-18-17(21)14-8-4-10-23-14)19-16(12-5-1-2-6-12)13-7-3-9-22-13/h3-4,7-10,12,16H,1-2,5-6,11H2,(H,18,21)(H,19,20) |
| InChIKey | ZCDALIXGQDYQBS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |