C19H23NO2S — CID 47031450
N-[cyclopentyl(thiophen-2-yl)methyl]-3-phenoxypropanamide (PubChem CID 47031450) has the molecular formula C19H23NO2S and a molecular weight of 329.46 g/mol. Its IUPAC name is N-[cyclopentyl(thiophen-2-yl)methyl]-3-phenoxypropanamide.
| Compound Name | N-[cyclopentyl(thiophen-2-yl)methyl]-3-phenoxypropanamide |
|---|---|
| PubChem CID | 47031450 |
| Molecular Formula | C19H23NO2S |
| Molecular Weight | 329.46 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | N-[cyclopentyl(thiophen-2-yl)methyl]-3-phenoxypropanamide |
| SMILES | O=C(CCOc1ccccc1)NC(c1cccs1)C1CCCC1 |
| InChI | InChI=1S/C19H23NO2S/c21-18(12-13-22-16-9-2-1-3-10-16)20-19(15-7-4-5-8-15)17-11-6-14-23-17/h1-3,6,9-11,14-15,19H,4-5,7-8,12-13H2,(H,20,21) |
| InChIKey | GXPZDTHQARBPIL-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.46 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |