C22H28N2O3S — CID 55837290
benzyl N-[4-[[cyclopentyl(thiophen-2-yl)methyl]amino]-4-oxobutyl]carbamate (PubChem CID 55837290) has the molecular formula C22H28N2O3S and a molecular weight of 400.54 g/mol. Its IUPAC name is benzyl N-[4-[[cyclopentyl(thiophen-2-yl)methyl]amino]-4-oxobutyl]carbamate.
| Compound Name | benzyl N-[4-[[cyclopentyl(thiophen-2-yl)methyl]amino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 55837290 |
| Molecular Formula | C22H28N2O3S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | benzyl N-[4-[[cyclopentyl(thiophen-2-yl)methyl]amino]-4-oxobutyl]carbamate |
| SMILES | O=C(CCCNC(=O)OCc1ccccc1)NC(c1cccs1)C1CCCC1 |
| InChI | InChI=1S/C22H28N2O3S/c25-20(24-21(18-10-4-5-11-18)19-12-7-15-28-19)13-6-14-23-22(26)27-16-17-8-2-1-3-9-17/h1-3,7-9,12,15,18,21H,4-6,10-11,13-14,16H2,(H,23,26)(H,24,25) |
| InChIKey | YMHOPRRDUAYILS-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|