C23H31N3O3S — CID 11524775
benzyl N-[3-[[4-(dimethylamino)-4-thiophen-2-ylcyclohexyl]amino]-3-oxopropyl]carbamate (PubChem CID 11524775) has the molecular formula C23H31N3O3S and a molecular weight of 429.59 g/mol. Its IUPAC name is benzyl N-[3-[[4-(dimethylamino)-4-thiophen-2-ylcyclohexyl]amino]-3-oxopropyl]carbamate.
| Compound Name | benzyl N-[3-[[4-(dimethylamino)-4-thiophen-2-ylcyclohexyl]amino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 11524775 |
| Molecular Formula | C23H31N3O3S |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | benzyl N-[3-[[4-(dimethylamino)-4-thiophen-2-ylcyclohexyl]amino]-3-oxopropyl]carbamate |
| SMILES | CN(C)C1(c2cccs2)CCC(NC(=O)CCNC(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C23H31N3O3S/c1-26(2)23(20-9-6-16-30-20)13-10-19(11-14-23)25-21(27)12-15-24-22(28)29-17-18-7-4-3-5-8-18/h3-9,16,19H,10-15,17H2,1-2H3,(H,24,28)(H,25,27) |
| InChIKey | LPMUUSDTZQONEM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |