C15H19NO5 — CID 15195445
ethyl 3-oxo-5-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 15195445) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is ethyl 3-oxo-5-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | ethyl 3-oxo-5-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 15195445 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | ethyl 3-oxo-5-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | CCOC(=O)CC(=O)CCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H19NO5/c1-2-20-14(18)10-13(17)8-9-16-15(19)21-11-12-6-4-3-5-7-12/h3-7H,2,8-11H2,1H3,(H,16,19) |
| InChIKey | UBAFRLFIQRXDBU-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|