C19H27NO5 — CID 121286565
ethyl 4-ethyl-3-oxo-7-(phenylmethoxycarbonylamino)heptanoate (PubChem CID 121286565) has the molecular formula C19H27NO5 and a molecular weight of 349.43 g/mol. Its IUPAC name is ethyl 4-ethyl-3-oxo-7-(phenylmethoxycarbonylamino)heptanoate.
| Compound Name | ethyl 4-ethyl-3-oxo-7-(phenylmethoxycarbonylamino)heptanoate |
|---|---|
| PubChem CID | 121286565 |
| Molecular Formula | C19H27NO5 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | ethyl 4-ethyl-3-oxo-7-(phenylmethoxycarbonylamino)heptanoate |
| SMILES | CCOC(=O)CC(=O)C(CC)CCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H27NO5/c1-3-16(17(21)13-18(22)24-4-2)11-8-12-20-19(23)25-14-15-9-6-5-7-10-15/h5-7,9-10,16H,3-4,8,11-14H2,1-2H3,(H,20,23) |
| InChIKey | PDBBJARWIPXLPI-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|