C23H34N2O7 — CID 68638994
ethyl 2-[(3-ethoxy-3-oxopropyl)amino]-3-oxo-8-(phenylmethoxycarbonylamino)octanoate (PubChem CID 68638994) has the molecular formula C23H34N2O7 and a molecular weight of 450.53 g/mol. Its IUPAC name is ethyl 2-[(3-ethoxy-3-oxopropyl)amino]-3-oxo-8-(phenylmethoxycarbonylamino)octanoate.
| Compound Name | ethyl 2-[(3-ethoxy-3-oxopropyl)amino]-3-oxo-8-(phenylmethoxycarbonylamino)octanoate |
|---|---|
| PubChem CID | 68638994 |
| Molecular Formula | C23H34N2O7 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | ethyl 2-[(3-ethoxy-3-oxopropyl)amino]-3-oxo-8-(phenylmethoxycarbonylamino)octanoate |
| SMILES | CCOC(=O)CCNC(C(=O)CCCCCNC(=O)OCc1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C23H34N2O7/c1-3-30-20(27)14-16-24-21(22(28)31-4-2)19(26)13-9-6-10-15-25-23(29)32-17-18-11-7-5-8-12-18/h5,7-8,11-12,21,24H,3-4,6,9-10,13-17H2,1-2H3,(H,25,29) |
| InChIKey | RGCVSRKKUXSZDU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|