C20H31NO4 — CID 158070429
ethyl (5S)-5-methyl-9-(phenylmethoxycarbonylamino)nonanoate (PubChem CID 158070429) has the molecular formula C20H31NO4 and a molecular weight of 349.47 g/mol. Its IUPAC name is ethyl (5S)-5-methyl-9-(phenylmethoxycarbonylamino)nonanoate.
| Compound Name | ethyl (5S)-5-methyl-9-(phenylmethoxycarbonylamino)nonanoate |
|---|---|
| PubChem CID | 158070429 |
| Molecular Formula | C20H31NO4 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | ethyl (5S)-5-methyl-9-(phenylmethoxycarbonylamino)nonanoate |
| SMILES | CCOC(=O)CCC[C@@H](C)CCCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H31NO4/c1-3-24-19(22)14-9-11-17(2)10-7-8-15-21-20(23)25-16-18-12-5-4-6-13-18/h4-6,12-13,17H,3,7-11,14-16H2,1-2H3,(H,21,23)/t17-/m0/s1 |
| InChIKey | UJAMYEXBVMACLK-KRWDZBQOSA-N |
| XLogP | 4.45 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|