C19H25NO8 — CID 154125275
1-O-ethyl 3-O-[2-methoxy-5-(phenylmethoxycarbonylamino)pentanoyl] propanedioate (PubChem CID 154125275) has the molecular formula C19H25NO8 and a molecular weight of 395.41 g/mol. Its IUPAC name is 1-O-ethyl 3-O-[2-methoxy-5-(phenylmethoxycarbonylamino)pentanoyl] propanedioate.
| Compound Name | 1-O-ethyl 3-O-[2-methoxy-5-(phenylmethoxycarbonylamino)pentanoyl] propanedioate |
|---|---|
| PubChem CID | 154125275 |
| Molecular Formula | C19H25NO8 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 1-O-ethyl 3-O-[2-methoxy-5-(phenylmethoxycarbonylamino)pentanoyl] propanedioate |
| SMILES | CCOC(=O)CC(=O)OC(=O)C(CCCNC(=O)OCc1ccccc1)OC |
| InChI | InChI=1S/C19H25NO8/c1-3-26-16(21)12-17(22)28-18(23)15(25-2)10-7-11-20-19(24)27-13-14-8-5-4-6-9-14/h4-6,8-9,15H,3,7,10-13H2,1-2H3,(H,20,24) |
| InChIKey | QNOCLMLTKMSMNP-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|