C15H22N2O4 — CID 87061313
benzyl N-[3-[butyl(hydroxy)amino]-3-oxopropyl]carbamate (PubChem CID 87061313) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is benzyl N-[3-[butyl(hydroxy)amino]-3-oxopropyl]carbamate.
| Compound Name | benzyl N-[3-[butyl(hydroxy)amino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 87061313 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | benzyl N-[3-[butyl(hydroxy)amino]-3-oxopropyl]carbamate |
| SMILES | CCCCN(O)C(=O)CCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H22N2O4/c1-2-3-11-17(20)14(18)9-10-16-15(19)21-12-13-7-5-4-6-8-13/h4-8,20H,2-3,9-12H2,1H3,(H,16,19) |
| InChIKey | XUINEKPILIQXQM-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|