C17H21NS — CID 43740592
N-benzyl-1-cyclopentyl-1-thiophen-2-ylmethanamine (PubChem CID 43740592) has the molecular formula C17H21NS and a molecular weight of 271.43 g/mol. Its IUPAC name is N-benzyl-1-cyclopentyl-1-thiophen-2-ylmethanamine.
| Compound Name | N-benzyl-1-cyclopentyl-1-thiophen-2-ylmethanamine |
|---|---|
| PubChem CID | 43740592 |
| Molecular Formula | C17H21NS |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | N-benzyl-1-cyclopentyl-1-thiophen-2-ylmethanamine |
| SMILES | c1ccc(CNC(c2cccs2)C2CCCC2)cc1 |
| InChI | InChI=1S/C17H21NS/c1-2-7-14(8-3-1)13-18-17(15-9-4-5-10-15)16-11-6-12-19-16/h1-3,6-8,11-12,15,17-18H,4-5,9-10,13H2 |
| InChIKey | IXLXEPMQNKTKAR-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |