C15H21N3S — CID 43740523
1-cyclopentyl-N-[(1-methylpyrazol-4-yl)methyl]-1-thiophen-2-ylmethanamine (PubChem CID 43740523) has the molecular formula C15H21N3S and a molecular weight of 275.42 g/mol. Its IUPAC name is 1-cyclopentyl-N-[(1-methylpyrazol-4-yl)methyl]-1-thiophen-2-ylmethanamine.
| Compound Name | 1-cyclopentyl-N-[(1-methylpyrazol-4-yl)methyl]-1-thiophen-2-ylmethanamine |
|---|---|
| PubChem CID | 43740523 |
| Molecular Formula | C15H21N3S |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 1-cyclopentyl-N-[(1-methylpyrazol-4-yl)methyl]-1-thiophen-2-ylmethanamine |
| SMILES | Cn1cc(CNC(c2cccs2)C2CCCC2)cn1 |
| InChI | InChI=1S/C15H21N3S/c1-18-11-12(10-17-18)9-16-15(13-5-2-3-6-13)14-7-4-8-19-14/h4,7-8,10-11,13,15-16H,2-3,5-6,9H2,1H3 |
| InChIKey | XMNHHDCDBFQUMY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |