C17H24N2S — CID 66414954
1-cyclopentyl-N-[(1-ethylpyrrol-3-yl)methyl]-1-thiophen-2-ylmethanamine (PubChem CID 66414954) has the molecular formula C17H24N2S and a molecular weight of 288.46 g/mol. Its IUPAC name is 1-cyclopentyl-N-[(1-ethylpyrrol-3-yl)methyl]-1-thiophen-2-ylmethanamine.
| Compound Name | 1-cyclopentyl-N-[(1-ethylpyrrol-3-yl)methyl]-1-thiophen-2-ylmethanamine |
|---|---|
| PubChem CID | 66414954 |
| Molecular Formula | C17H24N2S |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 1-cyclopentyl-N-[(1-ethylpyrrol-3-yl)methyl]-1-thiophen-2-ylmethanamine |
| SMILES | CCn1ccc(CNC(c2cccs2)C2CCCC2)c1 |
| InChI | InChI=1S/C17H24N2S/c1-2-19-10-9-14(13-19)12-18-17(15-6-3-4-7-15)16-8-5-11-20-16/h5,8-11,13,15,17-18H,2-4,6-7,12H2,1H3 |
| InChIKey | BLVMFQSDHAAJDG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |