C13H19NS — CID 43754683
N-[cyclopentyl(thiophen-2-yl)methyl]cyclopropanamine (PubChem CID 43754683) has the molecular formula C13H19NS and a molecular weight of 221.37 g/mol. Its IUPAC name is N-[cyclopentyl(thiophen-2-yl)methyl]cyclopropanamine.
| Compound Name | N-[cyclopentyl(thiophen-2-yl)methyl]cyclopropanamine |
|---|---|
| PubChem CID | 43754683 |
| Molecular Formula | C13H19NS |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | N-[cyclopentyl(thiophen-2-yl)methyl]cyclopropanamine |
| SMILES | c1csc(C(NC2CC2)C2CCCC2)c1 |
| InChI | InChI=1S/C13H19NS/c1-2-5-10(4-1)13(14-11-7-8-11)12-6-3-9-15-12/h3,6,9-11,13-14H,1-2,4-5,7-8H2 |
| InChIKey | RAGJUVHZTSVFIW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |