C18H28N2S — CID 115710812
N-[cyclopentyl(thiophen-2-yl)methyl]-1-cyclopropyl-5-methylpyrrolidin-3-amine (PubChem CID 115710812) has the molecular formula C18H28N2S and a molecular weight of 304.50 g/mol. Its IUPAC name is N-[cyclopentyl(thiophen-2-yl)methyl]-1-cyclopropyl-5-methylpyrrolidin-3-amine.
| Compound Name | N-[cyclopentyl(thiophen-2-yl)methyl]-1-cyclopropyl-5-methylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 115710812 |
| Molecular Formula | C18H28N2S |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | N-[cyclopentyl(thiophen-2-yl)methyl]-1-cyclopropyl-5-methylpyrrolidin-3-amine |
| SMILES | CC1CC(NC(c2cccs2)C2CCCC2)CN1C1CC1 |
| InChI | InChI=1S/C18H28N2S/c1-13-11-15(12-20(13)16-8-9-16)19-18(14-5-2-3-6-14)17-7-4-10-21-17/h4,7,10,13-16,18-19H,2-3,5-6,8-9,11-12H2,1H3 |
| InChIKey | SLAUEWIKJAQSLB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |