C13H19NS2 — CID 115576085
N-[cyclopropyl(thiophen-2-yl)methyl]thian-4-amine (PubChem CID 115576085) has the molecular formula C13H19NS2 and a molecular weight of 253.44 g/mol. Its IUPAC name is N-[cyclopropyl(thiophen-2-yl)methyl]thian-4-amine.
| Compound Name | N-[cyclopropyl(thiophen-2-yl)methyl]thian-4-amine |
|---|---|
| PubChem CID | 115576085 |
| Molecular Formula | C13H19NS2 |
| Molecular Weight | 253.44 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | N-[cyclopropyl(thiophen-2-yl)methyl]thian-4-amine |
| SMILES | c1csc(C(NC2CCSCC2)C2CC2)c1 |
| InChI | InChI=1S/C13H19NS2/c1-2-12(16-7-1)13(10-3-4-10)14-11-5-8-15-9-6-11/h1-2,7,10-11,13-14H,3-6,8-9H2 |
| InChIKey | DDXRBZZJDYYNGK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |