C15H23NS2 — CID 103926276
N-[cyclopropyl(thiophen-2-yl)methyl]-3-ethylsulfanylcyclopentan-1-amine (PubChem CID 103926276) has the molecular formula C15H23NS2 and a molecular weight of 281.49 g/mol. Its IUPAC name is N-[cyclopropyl(thiophen-2-yl)methyl]-3-ethylsulfanylcyclopentan-1-amine.
| Compound Name | N-[cyclopropyl(thiophen-2-yl)methyl]-3-ethylsulfanylcyclopentan-1-amine |
|---|---|
| PubChem CID | 103926276 |
| Molecular Formula | C15H23NS2 |
| Molecular Weight | 281.49 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | N-[cyclopropyl(thiophen-2-yl)methyl]-3-ethylsulfanylcyclopentan-1-amine |
| SMILES | CCSC1CCC(NC(c2cccs2)C2CC2)C1 |
| InChI | InChI=1S/C15H23NS2/c1-2-17-13-8-7-12(10-13)16-15(11-5-6-11)14-4-3-9-18-14/h3-4,9,11-13,15-16H,2,5-8,10H2,1H3 |
| InChIKey | WPNAXIDKVXRFKO-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |