C17H23NS2 — CID 43740511
N-[cyclopentyl(thiophen-2-yl)methyl]-1-thiophen-2-ylpropan-1-amine (PubChem CID 43740511) has the molecular formula C17H23NS2 and a molecular weight of 305.51 g/mol. Its IUPAC name is N-[cyclopentyl(thiophen-2-yl)methyl]-1-thiophen-2-ylpropan-1-amine.
| Compound Name | N-[cyclopentyl(thiophen-2-yl)methyl]-1-thiophen-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 43740511 |
| Molecular Formula | C17H23NS2 |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | N-[cyclopentyl(thiophen-2-yl)methyl]-1-thiophen-2-ylpropan-1-amine |
| SMILES | CCC(NC(c1cccs1)C1CCCC1)c1cccs1 |
| InChI | InChI=1S/C17H23NS2/c1-2-14(15-9-5-11-19-15)18-17(13-7-3-4-8-13)16-10-6-12-20-16/h5-6,9-14,17-18H,2-4,7-8H2,1H3 |
| InChIKey | SBYIIIKBTZYQFU-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |