C18H23NOS — CID 107862229
(2S)-2-[[cyclopentyl(thiophen-2-yl)methyl]amino]-2-phenylethanol (PubChem CID 107862229) has the molecular formula C18H23NOS and a molecular weight of 301.45 g/mol. Its IUPAC name is (2S)-2-[[cyclopentyl(thiophen-2-yl)methyl]amino]-2-phenylethanol.
| Compound Name | (2S)-2-[[cyclopentyl(thiophen-2-yl)methyl]amino]-2-phenylethanol |
|---|---|
| PubChem CID | 107862229 |
| Molecular Formula | C18H23NOS |
| Molecular Weight | 301.45 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | (2S)-2-[[cyclopentyl(thiophen-2-yl)methyl]amino]-2-phenylethanol |
| SMILES | OC[C@@H](NC(c1cccs1)C1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C18H23NOS/c20-13-16(14-7-2-1-3-8-14)19-18(15-9-4-5-10-15)17-11-6-12-21-17/h1-3,6-8,11-12,15-16,18-20H,4-5,9-10,13H2/t16-,18?/m1/s1 |
| InChIKey | ZYHQQGYDFALBOV-PYUWXLGESA-N |
| XLogP | 4.30 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |