C17H22FN3 — CID 97055776
(1R)-1-cyclopentyl-1-(2-fluorophenyl)-N-[(1-methylpyrazol-4-yl)methyl]methanamine (PubChem CID 97055776) has the molecular formula C17H22FN3 and a molecular weight of 287.38 g/mol. Its IUPAC name is (1R)-1-cyclopentyl-1-(2-fluorophenyl)-N-[(1-methylpyrazol-4-yl)methyl]methanamine.
| Compound Name | (1R)-1-cyclopentyl-1-(2-fluorophenyl)-N-[(1-methylpyrazol-4-yl)methyl]methanamine |
|---|---|
| PubChem CID | 97055776 |
| Molecular Formula | C17H22FN3 |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.18 |
| IUPAC Name | (1R)-1-cyclopentyl-1-(2-fluorophenyl)-N-[(1-methylpyrazol-4-yl)methyl]methanamine |
| SMILES | Cn1cc(CN[C@@H](c2ccccc2F)C2CCCC2)cn1 |
| InChI | InChI=1S/C17H22FN3/c1-21-12-13(11-20-21)10-19-17(14-6-2-3-7-14)15-8-4-5-9-16(15)18/h4-5,8-9,11-12,14,17,19H,2-3,6-7,10H2,1H3/t17-/m1/s1 |
| InChIKey | PVZQVPDTCHWAFH-QGZVFWFLSA-N |
| XLogP | 3.58 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |