C19H22FN3 — CID 167794301
1-cyclopentyl-N-[(4-fluorophenyl)methyl]-3-(1-methylpyrazol-4-yl)prop-2-yn-1-amine (PubChem CID 167794301) has the molecular formula C19H22FN3 and a molecular weight of 311.40 g/mol. Its IUPAC name is 1-cyclopentyl-N-[(4-fluorophenyl)methyl]-3-(1-methylpyrazol-4-yl)prop-2-yn-1-amine.
| Compound Name | 1-cyclopentyl-N-[(4-fluorophenyl)methyl]-3-(1-methylpyrazol-4-yl)prop-2-yn-1-amine |
|---|---|
| PubChem CID | 167794301 |
| Molecular Formula | C19H22FN3 |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | 1-cyclopentyl-N-[(4-fluorophenyl)methyl]-3-(1-methylpyrazol-4-yl)prop-2-yn-1-amine |
| SMILES | Cn1cc(C#CC(NCc2ccc(F)cc2)C2CCCC2)cn1 |
| InChI | InChI=1S/C19H22FN3/c1-23-14-16(13-22-23)8-11-19(17-4-2-3-5-17)21-12-15-6-9-18(20)10-7-15/h6-7,9-10,13-14,17,19,21H,2-5,12H2,1H3 |
| InChIKey | CNDGHPNREKTYNT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|