C21H27N3O5S2 — CID 55824769
benzyl N-[4-oxo-4-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]butyl]carbamate (PubChem CID 55824769) has the molecular formula C21H27N3O5S2 and a molecular weight of 465.60 g/mol. Its IUPAC name is benzyl N-[4-oxo-4-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]butyl]carbamate.
| Compound Name | benzyl N-[4-oxo-4-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]butyl]carbamate |
|---|---|
| PubChem CID | 55824769 |
| Molecular Formula | C21H27N3O5S2 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | benzyl N-[4-oxo-4-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]butyl]carbamate |
| SMILES | O=C(NCCCC(=O)N1CCC(NS(=O)(=O)c2cccs2)CC1)OCc1ccccc1 |
| InChI | InChI=1S/C21H27N3O5S2/c25-19(8-4-12-22-21(26)29-16-17-6-2-1-3-7-17)24-13-10-18(11-14-24)23-31(27,28)20-9-5-15-30-20/h1-3,5-7,9,15,18,23H,4,8,10-14,16H2,(H,22,26) |
| InChIKey | ORSDPIGVQVYPAV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|