C17H21N3O4S3 — CID 33172544
N-[3-oxo-3-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]propyl]thiophene-3-carboxamide (PubChem CID 33172544) has the molecular formula C17H21N3O4S3 and a molecular weight of 427.57 g/mol. Its IUPAC name is N-[3-oxo-3-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]propyl]thiophene-3-carboxamide.
| Compound Name | N-[3-oxo-3-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]propyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 33172544 |
| Molecular Formula | C17H21N3O4S3 |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | N-[3-oxo-3-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]propyl]thiophene-3-carboxamide |
| SMILES | O=C(NCCC(=O)N1CCC(NS(=O)(=O)c2cccs2)CC1)c1ccsc1 |
| InChI | InChI=1S/C17H21N3O4S3/c21-15(3-7-18-17(22)13-6-11-25-12-13)20-8-4-14(5-9-20)19-27(23,24)16-2-1-10-26-16/h1-2,6,10-12,14,19H,3-5,7-9H2,(H,18,22) |
| InChIKey | ANYCJTPHKBDMHF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |