C14H19N3O4S3 — CID 38170585
N-[1-[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]piperidin-4-yl]thiophene-2-sulfonamide (PubChem CID 38170585) has the molecular formula C14H19N3O4S3 and a molecular weight of 389.52 g/mol. Its IUPAC name is N-[1-[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]piperidin-4-yl]thiophene-2-sulfonamide.
| Compound Name | N-[1-[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]piperidin-4-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 38170585 |
| Molecular Formula | C14H19N3O4S3 |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | N-[1-[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]piperidin-4-yl]thiophene-2-sulfonamide |
| SMILES | O=C(CN1CCSC1=O)N1CCC(NS(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C14H19N3O4S3/c18-12(10-17-7-9-23-14(17)19)16-5-3-11(4-6-16)15-24(20,21)13-2-1-8-22-13/h1-2,8,11,15H,3-7,9-10H2 |
| InChIKey | AACHZYLTSSLNLE-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|