C20H22BrN3O3S2 — CID 60520173
N-[1-[2-(3-bromo-2-methylindol-1-yl)acetyl]piperidin-4-yl]thiophene-2-sulfonamide (PubChem CID 60520173) has the molecular formula C20H22BrN3O3S2 and a molecular weight of 496.45 g/mol. Its IUPAC name is N-[1-[2-(3-bromo-2-methylindol-1-yl)acetyl]piperidin-4-yl]thiophene-2-sulfonamide.
| Compound Name | N-[1-[2-(3-bromo-2-methylindol-1-yl)acetyl]piperidin-4-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 60520173 |
| Molecular Formula | C20H22BrN3O3S2 |
| Molecular Weight | 496.45 g/mol |
| Exact Mass | 495.03 |
| IUPAC Name | N-[1-[2-(3-bromo-2-methylindol-1-yl)acetyl]piperidin-4-yl]thiophene-2-sulfonamide |
| SMILES | Cc1c(Br)c2ccccc2n1CC(=O)N1CCC(NS(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C20H22BrN3O3S2/c1-14-20(21)16-5-2-3-6-17(16)24(14)13-18(25)23-10-8-15(9-11-23)22-29(26,27)19-7-4-12-28-19/h2-7,12,15,22H,8-11,13H2,1H3 |
| InChIKey | QVHDMHFYSZNBFM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.45 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |