C14H23N3O3S2 — CID 119726760
N-[1-[2-methyl-3-(methylamino)propanoyl]piperidin-4-yl]thiophene-2-sulfonamide (PubChem CID 119726760) has the molecular formula C14H23N3O3S2 and a molecular weight of 345.49 g/mol. Its IUPAC name is N-[1-[2-methyl-3-(methylamino)propanoyl]piperidin-4-yl]thiophene-2-sulfonamide.
| Compound Name | N-[1-[2-methyl-3-(methylamino)propanoyl]piperidin-4-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 119726760 |
| Molecular Formula | C14H23N3O3S2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | N-[1-[2-methyl-3-(methylamino)propanoyl]piperidin-4-yl]thiophene-2-sulfonamide |
| SMILES | CNCC(C)C(=O)N1CCC(NS(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C14H23N3O3S2/c1-11(10-15-2)14(18)17-7-5-12(6-8-17)16-22(19,20)13-4-3-9-21-13/h3-4,9,11-12,15-16H,5-8,10H2,1-2H3 |
| InChIKey | OVEDVUKXKOZEMN-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |