C18H21N3O5S3 — CID 46604032
N-[1-[2-(4-nitrophenyl)sulfanylpropanoyl]piperidin-4-yl]thiophene-2-sulfonamide (PubChem CID 46604032) has the molecular formula C18H21N3O5S3 and a molecular weight of 455.58 g/mol. Its IUPAC name is N-[1-[2-(4-nitrophenyl)sulfanylpropanoyl]piperidin-4-yl]thiophene-2-sulfonamide.
| Compound Name | N-[1-[2-(4-nitrophenyl)sulfanylpropanoyl]piperidin-4-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 46604032 |
| Molecular Formula | C18H21N3O5S3 |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | N-[1-[2-(4-nitrophenyl)sulfanylpropanoyl]piperidin-4-yl]thiophene-2-sulfonamide |
| SMILES | CC(Sc1ccc([N+](=O)[O-])cc1)C(=O)N1CCC(NS(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C18H21N3O5S3/c1-13(28-16-6-4-15(5-7-16)21(23)24)18(22)20-10-8-14(9-11-20)19-29(25,26)17-3-2-12-27-17/h2-7,12-14,19H,8-11H2,1H3 |
| InChIKey | CJSCIJFMTHPGAM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|