C13H21N3O3S2 — CID 119291200
N-[1-(4-aminobutanoyl)piperidin-4-yl]thiophene-2-sulfonamide (PubChem CID 119291200) has the molecular formula C13H21N3O3S2 and a molecular weight of 331.46 g/mol. Its IUPAC name is N-[1-(4-aminobutanoyl)piperidin-4-yl]thiophene-2-sulfonamide.
| Compound Name | N-[1-(4-aminobutanoyl)piperidin-4-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 119291200 |
| Molecular Formula | C13H21N3O3S2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | N-[1-(4-aminobutanoyl)piperidin-4-yl]thiophene-2-sulfonamide |
| SMILES | NCCCC(=O)N1CCC(NS(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C13H21N3O3S2/c14-7-1-3-12(17)16-8-5-11(6-9-16)15-21(18,19)13-4-2-10-20-13/h2,4,10-11,15H,1,3,5-9,14H2 |
| InChIKey | RQYDWSIRUMJHFE-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |