C18H20Cl2N2O3S2 — CID 39205864
N-[1-[3-(2,4-dichlorophenyl)propanoyl]piperidin-4-yl]thiophene-2-sulfonamide (PubChem CID 39205864) has the molecular formula C18H20Cl2N2O3S2 and a molecular weight of 447.41 g/mol. Its IUPAC name is N-[1-[3-(2,4-dichlorophenyl)propanoyl]piperidin-4-yl]thiophene-2-sulfonamide.
| Compound Name | N-[1-[3-(2,4-dichlorophenyl)propanoyl]piperidin-4-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 39205864 |
| Molecular Formula | C18H20Cl2N2O3S2 |
| Molecular Weight | 447.41 g/mol |
| Exact Mass | 446.03 |
| IUPAC Name | N-[1-[3-(2,4-dichlorophenyl)propanoyl]piperidin-4-yl]thiophene-2-sulfonamide |
| SMILES | O=C(CCc1ccc(Cl)cc1Cl)N1CCC(NS(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C18H20Cl2N2O3S2/c19-14-5-3-13(16(20)12-14)4-6-17(23)22-9-7-15(8-10-22)21-27(24,25)18-2-1-11-26-18/h1-3,5,11-12,15,21H,4,6-10H2 |
| InChIKey | IWXZQCLFFKLYRF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |