C16H20Cl2N2O3S — CID 149101841
N-[1-[3-(2,4-dichlorophenyl)propanoyl]piperidin-4-yl]ethenesulfonamide (PubChem CID 149101841) has the molecular formula C16H20Cl2N2O3S and a molecular weight of 391.32 g/mol. Its IUPAC name is N-[1-[3-(2,4-dichlorophenyl)propanoyl]piperidin-4-yl]ethenesulfonamide.
| Compound Name | N-[1-[3-(2,4-dichlorophenyl)propanoyl]piperidin-4-yl]ethenesulfonamide |
|---|---|
| PubChem CID | 149101841 |
| Molecular Formula | C16H20Cl2N2O3S |
| Molecular Weight | 391.32 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | N-[1-[3-(2,4-dichlorophenyl)propanoyl]piperidin-4-yl]ethenesulfonamide |
| SMILES | C=CS(=O)(=O)NC1CCN(C(=O)CCc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C16H20Cl2N2O3S/c1-2-24(22,23)19-14-7-9-20(10-8-14)16(21)6-4-12-3-5-13(17)11-15(12)18/h2-3,5,11,14,19H,1,4,6-10H2 |
| InChIKey | QUUAAJYNMRAVFA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |