C17H24Cl2N2O — CID 109014364
3-[2-(2,4-dichlorophenyl)ethylamino]-1-(4-methylpiperidin-1-yl)propan-1-one (PubChem CID 109014364) has the molecular formula C17H24Cl2N2O and a molecular weight of 343.30 g/mol. Its IUPAC name is 3-[2-(2,4-dichlorophenyl)ethylamino]-1-(4-methylpiperidin-1-yl)propan-1-one.
| Compound Name | 3-[2-(2,4-dichlorophenyl)ethylamino]-1-(4-methylpiperidin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 109014364 |
| Molecular Formula | C17H24Cl2N2O |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 3-[2-(2,4-dichlorophenyl)ethylamino]-1-(4-methylpiperidin-1-yl)propan-1-one |
| SMILES | CC1CCN(C(=O)CCNCCc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C17H24Cl2N2O/c1-13-6-10-21(11-7-13)17(22)5-9-20-8-4-14-2-3-15(18)12-16(14)19/h2-3,12-13,20H,4-11H2,1H3 |
| InChIKey | IOAMBKTWGCMVRF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|