4-[2-(2,4-dichlorophenyl)ethylamino]butanoic acid

C12H15Cl2NO2 — CID 43377886

IUPAC4-[2-(2,4-dichlorophenyl)ethylamino]butanoic acid
SMILESO=C(O)CCCNCCc1ccc(Cl)cc1Cl
InChIInChI=1S/C12H15Cl2NO2/c13-10-4-3-9(11(14)8-10)5-7-15-6-1-2-12(16)17/h3-4,8,15H,1-2,5-7H2,(H,16,17)
InChIKeyRNJAXSMZYOSMIT-UHFFFAOYSA-N
MW276.16 g/mol
LogP2.99
Rot. Bonds7

About 4-[2-(2,4-dichlorophenyl)ethylamino]butanoic acid

4-[2-(2,4-dichlorophenyl)ethylamino]butanoic acid (PubChem CID 43377886) has the molecular formula C12H15Cl2NO2 and a molecular weight of 276.16 g/mol. Its IUPAC name is 4-[2-(2,4-dichlorophenyl)ethylamino]butanoic acid.

Molecular Properties

Compound Name4-[2-(2,4-dichlorophenyl)ethylamino]butanoic acid
PubChem CID43377886
Molecular FormulaC12H15Cl2NO2
Molecular Weight276.16 g/mol
Exact Mass275.05
IUPAC Name4-[2-(2,4-dichlorophenyl)ethylamino]butanoic acid
SMILESO=C(O)CCCNCCc1ccc(Cl)cc1Cl
InChIInChI=1S/C12H15Cl2NO2/c13-10-4-3-9(11(14)8-10)5-7-15-6-1-2-12(16)17/h3-4,8,15H,1-2,5-7H2,(H,16,17)
InChIKeyRNJAXSMZYOSMIT-UHFFFAOYSA-N
XLogP2.99
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.16
LogP ≤ 52.99
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-[2-(2,4-dichlorophenyl)ethylamino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[2-(2,4-dichlorophenyl)ethylamino]butanoic acid?
The IUPAC name of 4-[2-(2,4-dichlorophenyl)ethylamino]butanoic acid (CID 43377886) is 4-[2-(2,4-dichlorophenyl)ethylamino]butanoic acid.
What is the SMILES notation for 4-[2-(2,4-dichlorophenyl)ethylamino]butanoic acid?
The canonical SMILES for 4-[2-(2,4-dichlorophenyl)ethylamino]butanoic acid is O=C(O)CCCNCCc1ccc(Cl)cc1Cl.
What is the InChIKey of 4-[2-(2,4-dichlorophenyl)ethylamino]butanoic acid?
The InChIKey is RNJAXSMZYOSMIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15Cl2NO2/c13-10-4-3-9(11(14)8-10)5-7-15-6-1-2-12(16)17/h3-4,8,15H,1-2,5-7H2,(H,16,17).
What are the key properties of 4-[2-(2,4-dichlorophenyl)ethylamino]butanoic acid?
4-[2-(2,4-dichlorophenyl)ethylamino]butanoic acid has a molecular weight of 276.16 g/mol, XLogP of 2.99, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2,4-dichlorophenyl)ethylamino]butanoic acid is sourced from PubChem (CID 43377886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).