C12H15Cl2NO2 — CID 43377886
4-[2-(2,4-dichlorophenyl)ethylamino]butanoic acid (PubChem CID 43377886) has the molecular formula C12H15Cl2NO2 and a molecular weight of 276.16 g/mol. Its IUPAC name is 4-[2-(2,4-dichlorophenyl)ethylamino]butanoic acid.
| Compound Name | 4-[2-(2,4-dichlorophenyl)ethylamino]butanoic acid |
|---|---|
| PubChem CID | 43377886 |
| Molecular Formula | C12H15Cl2NO2 |
| Molecular Weight | 276.16 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 4-[2-(2,4-dichlorophenyl)ethylamino]butanoic acid |
| SMILES | O=C(O)CCCNCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H15Cl2NO2/c13-10-4-3-9(11(14)8-10)5-7-15-6-1-2-12(16)17/h3-4,8,15H,1-2,5-7H2,(H,16,17) |
| InChIKey | RNJAXSMZYOSMIT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.16 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|