C16H16Cl3NO2 — CID 17209952
4-[[2-(2,4-dichlorophenyl)ethylamino]methyl]benzoic acid;hydrochloride (PubChem CID 17209952) has the molecular formula C16H16Cl3NO2 and a molecular weight of 360.67 g/mol. Its IUPAC name is 4-[[2-(2,4-dichlorophenyl)ethylamino]methyl]benzoic acid;hydrochloride.
| Compound Name | 4-[[2-(2,4-dichlorophenyl)ethylamino]methyl]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 17209952 |
| Molecular Formula | C16H16Cl3NO2 |
| Molecular Weight | 360.67 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | 4-[[2-(2,4-dichlorophenyl)ethylamino]methyl]benzoic acid;hydrochloride |
| SMILES | Cl.O=C(O)c1ccc(CNCCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C16H15Cl2NO2.ClH/c17-14-6-5-12(15(18)9-14)7-8-19-10-11-1-3-13(4-2-11)16(20)21;/h1-6,9,19H,7-8,10H2,(H,20,21);1H |
| InChIKey | VNRJHDAWLADDEE-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.67 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|