C13H12Cl2N2O2S — CID 103233818
4-[[2-(2,4-dichlorophenyl)ethylamino]methyl]-1,3-thiazole-2-carboxylic acid (PubChem CID 103233818) has the molecular formula C13H12Cl2N2O2S and a molecular weight of 331.22 g/mol. Its IUPAC name is 4-[[2-(2,4-dichlorophenyl)ethylamino]methyl]-1,3-thiazole-2-carboxylic acid.
| Compound Name | 4-[[2-(2,4-dichlorophenyl)ethylamino]methyl]-1,3-thiazole-2-carboxylic acid |
|---|---|
| PubChem CID | 103233818 |
| Molecular Formula | C13H12Cl2N2O2S |
| Molecular Weight | 331.22 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | 4-[[2-(2,4-dichlorophenyl)ethylamino]methyl]-1,3-thiazole-2-carboxylic acid |
| SMILES | O=C(O)c1nc(CNCCc2ccc(Cl)cc2Cl)cs1 |
| InChI | InChI=1S/C13H12Cl2N2O2S/c14-9-2-1-8(11(15)5-9)3-4-16-6-10-7-20-12(17-10)13(18)19/h1-2,5,7,16H,3-4,6H2,(H,18,19) |
| InChIKey | WVKLMRFFIWABRX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.22 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|