C8H9F3N2O2S — CID 103250366
4-[(3,3,3-trifluoropropylamino)methyl]-1,3-thiazole-2-carboxylic acid (PubChem CID 103250366) has the molecular formula C8H9F3N2O2S and a molecular weight of 254.23 g/mol. Its IUPAC name is 4-[(3,3,3-trifluoropropylamino)methyl]-1,3-thiazole-2-carboxylic acid.
| Compound Name | 4-[(3,3,3-trifluoropropylamino)methyl]-1,3-thiazole-2-carboxylic acid |
|---|---|
| PubChem CID | 103250366 |
| Molecular Formula | C8H9F3N2O2S |
| Molecular Weight | 254.23 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 4-[(3,3,3-trifluoropropylamino)methyl]-1,3-thiazole-2-carboxylic acid |
| SMILES | O=C(O)c1nc(CNCCC(F)(F)F)cs1 |
| InChI | InChI=1S/C8H9F3N2O2S/c9-8(10,11)1-2-12-3-5-4-16-6(13-5)7(14)15/h4,12H,1-3H2,(H,14,15) |
| InChIKey | TVSVFAQGCMAGQB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.23 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|