C9H15N3O4S2 — CID 114175672
4-[[3-(methanesulfonamido)propylamino]methyl]-1,3-thiazole-2-carboxylic acid (PubChem CID 114175672) has the molecular formula C9H15N3O4S2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 4-[[3-(methanesulfonamido)propylamino]methyl]-1,3-thiazole-2-carboxylic acid.
| Compound Name | 4-[[3-(methanesulfonamido)propylamino]methyl]-1,3-thiazole-2-carboxylic acid |
|---|---|
| PubChem CID | 114175672 |
| Molecular Formula | C9H15N3O4S2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 4-[[3-(methanesulfonamido)propylamino]methyl]-1,3-thiazole-2-carboxylic acid |
| SMILES | CS(=O)(=O)NCCCNCc1csc(C(=O)O)n1 |
| InChI | InChI=1S/C9H15N3O4S2/c1-18(15,16)11-4-2-3-10-5-7-6-17-8(12-7)9(13)14/h6,10-11H,2-5H2,1H3,(H,13,14) |
| InChIKey | GXYGLGJUSZMBSK-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|