C12H20N2O3S — CID 106004066
4-[(4-propan-2-yloxybutylamino)methyl]-1,3-thiazole-2-carboxylic acid (PubChem CID 106004066) has the molecular formula C12H20N2O3S and a molecular weight of 272.37 g/mol. Its IUPAC name is 4-[(4-propan-2-yloxybutylamino)methyl]-1,3-thiazole-2-carboxylic acid.
| Compound Name | 4-[(4-propan-2-yloxybutylamino)methyl]-1,3-thiazole-2-carboxylic acid |
|---|---|
| PubChem CID | 106004066 |
| Molecular Formula | C12H20N2O3S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 4-[(4-propan-2-yloxybutylamino)methyl]-1,3-thiazole-2-carboxylic acid |
| SMILES | CC(C)OCCCCNCc1csc(C(=O)O)n1 |
| InChI | InChI=1S/C12H20N2O3S/c1-9(2)17-6-4-3-5-13-7-10-8-18-11(14-10)12(15)16/h8-9,13H,3-7H2,1-2H3,(H,15,16) |
| InChIKey | LYYGXDPWGQZVDN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|