C8H12N2O3S2 — CID 103266185
4-[(2-methylsulfinylethylamino)methyl]-1,3-thiazole-2-carboxylic acid (PubChem CID 103266185) has the molecular formula C8H12N2O3S2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 4-[(2-methylsulfinylethylamino)methyl]-1,3-thiazole-2-carboxylic acid.
| Compound Name | 4-[(2-methylsulfinylethylamino)methyl]-1,3-thiazole-2-carboxylic acid |
|---|---|
| PubChem CID | 103266185 |
| Molecular Formula | C8H12N2O3S2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | 4-[(2-methylsulfinylethylamino)methyl]-1,3-thiazole-2-carboxylic acid |
| SMILES | CS(=O)CCNCc1csc(C(=O)O)n1 |
| InChI | InChI=1S/C8H12N2O3S2/c1-15(13)3-2-9-4-6-5-14-7(10-6)8(11)12/h5,9H,2-4H2,1H3,(H,11,12) |
| InChIKey | OIADEMOKDKOQJM-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|