C13H12F2N2O2S — CID 103249016
4-[[2-(3,5-difluorophenyl)ethylamino]methyl]-1,3-thiazole-2-carboxylic acid (PubChem CID 103249016) has the molecular formula C13H12F2N2O2S and a molecular weight of 298.31 g/mol. Its IUPAC name is 4-[[2-(3,5-difluorophenyl)ethylamino]methyl]-1,3-thiazole-2-carboxylic acid.
| Compound Name | 4-[[2-(3,5-difluorophenyl)ethylamino]methyl]-1,3-thiazole-2-carboxylic acid |
|---|---|
| PubChem CID | 103249016 |
| Molecular Formula | C13H12F2N2O2S |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 4-[[2-(3,5-difluorophenyl)ethylamino]methyl]-1,3-thiazole-2-carboxylic acid |
| SMILES | O=C(O)c1nc(CNCCc2cc(F)cc(F)c2)cs1 |
| InChI | InChI=1S/C13H12F2N2O2S/c14-9-3-8(4-10(15)5-9)1-2-16-6-11-7-20-12(17-11)13(18)19/h3-5,7,16H,1-2,6H2,(H,18,19) |
| InChIKey | WYTJNIZUGGUVTD-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|