C5H6N2O3S — CID 103282713
4-[(hydroxyamino)methyl]-1,3-thiazole-2-carboxylic acid (PubChem CID 103282713) has the molecular formula C5H6N2O3S and a molecular weight of 174.18 g/mol. Its IUPAC name is 4-[(hydroxyamino)methyl]-1,3-thiazole-2-carboxylic acid.
| Compound Name | 4-[(hydroxyamino)methyl]-1,3-thiazole-2-carboxylic acid |
|---|---|
| PubChem CID | 103282713 |
| Molecular Formula | C5H6N2O3S |
| Molecular Weight | 174.18 g/mol |
| Exact Mass | 174.01 |
| IUPAC Name | 4-[(hydroxyamino)methyl]-1,3-thiazole-2-carboxylic acid |
| SMILES | O=C(O)c1nc(CNO)cs1 |
| InChI | InChI=1S/C5H6N2O3S/c8-5(9)4-7-3(1-6-10)2-11-4/h2,6,10H,1H2,(H,8,9) |
| InChIKey | ZZEFMEONROFIMQ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.18 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|