C11H12N2O3S — CID 103242182
4-[[2-(furan-2-yl)ethylamino]methyl]-1,3-thiazole-2-carboxylic acid (PubChem CID 103242182) has the molecular formula C11H12N2O3S and a molecular weight of 252.29 g/mol. Its IUPAC name is 4-[[2-(furan-2-yl)ethylamino]methyl]-1,3-thiazole-2-carboxylic acid.
| Compound Name | 4-[[2-(furan-2-yl)ethylamino]methyl]-1,3-thiazole-2-carboxylic acid |
|---|---|
| PubChem CID | 103242182 |
| Molecular Formula | C11H12N2O3S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 4-[[2-(furan-2-yl)ethylamino]methyl]-1,3-thiazole-2-carboxylic acid |
| SMILES | O=C(O)c1nc(CNCCc2ccco2)cs1 |
| InChI | InChI=1S/C11H12N2O3S/c14-11(15)10-13-8(7-17-10)6-12-4-3-9-2-1-5-16-9/h1-2,5,7,12H,3-4,6H2,(H,14,15) |
| InChIKey | KNUVLLPNAKOFDZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|