C11H13NOS — CID 43395504
2-(furan-2-yl)-N-(thiophen-3-ylmethyl)ethanamine (PubChem CID 43395504) has the molecular formula C11H13NOS and a molecular weight of 207.30 g/mol. Its IUPAC name is 2-(furan-2-yl)-N-(thiophen-3-ylmethyl)ethanamine.
| Compound Name | 2-(furan-2-yl)-N-(thiophen-3-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 43395504 |
| Molecular Formula | C11H13NOS |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 2-(furan-2-yl)-N-(thiophen-3-ylmethyl)ethanamine |
| SMILES | c1coc(CCNCc2ccsc2)c1 |
| InChI | InChI=1S/C11H13NOS/c1-2-11(13-6-1)3-5-12-8-10-4-7-14-9-10/h1-2,4,6-7,9,12H,3,5,8H2 |
| InChIKey | IHMIOAUYPVRWFX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|