C13H17NOS — CID 43182405
4-(furan-2-yl)-N-(thiophen-3-ylmethyl)butan-2-amine (PubChem CID 43182405) has the molecular formula C13H17NOS and a molecular weight of 235.35 g/mol. Its IUPAC name is 4-(furan-2-yl)-N-(thiophen-3-ylmethyl)butan-2-amine.
| Compound Name | 4-(furan-2-yl)-N-(thiophen-3-ylmethyl)butan-2-amine |
|---|---|
| PubChem CID | 43182405 |
| Molecular Formula | C13H17NOS |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 4-(furan-2-yl)-N-(thiophen-3-ylmethyl)butan-2-amine |
| SMILES | CC(CCc1ccco1)NCc1ccsc1 |
| InChI | InChI=1S/C13H17NOS/c1-11(4-5-13-3-2-7-15-13)14-9-12-6-8-16-10-12/h2-3,6-8,10-11,14H,4-5,9H2,1H3 |
| InChIKey | MIFDWRNWTANQDE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |